C36H48N4 — CID 162179968
(9Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 162179968) has the molecular formula C36H48N4 and a molecular weight of 536.81 g/mol. Its IUPAC name is (9Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | (9Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 162179968 |
| Molecular Formula | C36H48N4 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.39 |
| IUPAC Name | (9Z,15Z)-2,3,7,8,12,13,17,18-octaethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCc1c2[nH]c(c1CC)C=c1[nH]/c(c(CC)c1CC)=C\c1[nH]c(c(CC)c1CC)/C=c1\[nH]c(c(CC)c1CC)=C2 |
| InChI | InChI=1S/C36H48N4/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30/h17-20,37-40H,9-16H2,1-8H3/b29-17-,30-18-,31-17-,32-18-,33-19?,34-20?,35-19?,36-20? |
| InChIKey | YDMHBFJFHISTSS-OYEGGPACSA-N |
| XLogP | 5.13 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |