C33H42N4O4 — CID 86280437
3-[(1R,5Z,9Z,15Z,19R)-12-(2-carboxyethyl)-1,2,3,7,13,17,18,19-octamethyl-21,22,23,24-tetrahydro-2H-corrin-8-yl]propanoic acid (PubChem CID 86280437) has the molecular formula C33H42N4O4 and a molecular weight of 558.72 g/mol. Its IUPAC name is 3-[(1R,5Z,9Z,15Z,19R)-12-(2-carboxyethyl)-1,2,3,7,13,17,18,19-octamethyl-21,22,23,24-tetrahydro-2H-corrin-8-yl]propanoic acid.
| Compound Name | 3-[(1R,5Z,9Z,15Z,19R)-12-(2-carboxyethyl)-1,2,3,7,13,17,18,19-octamethyl-21,22,23,24-tetrahydro-2H-corrin-8-yl]propanoic acid |
|---|---|
| PubChem CID | 86280437 |
| Molecular Formula | C33H42N4O4 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | 3-[(1R,5Z,9Z,15Z,19R)-12-(2-carboxyethyl)-1,2,3,7,13,17,18,19-octamethyl-21,22,23,24-tetrahydro-2H-corrin-8-yl]propanoic acid |
| SMILES | CC1=C(C)[C@@]2(C)N/C1=C\c1[nH]c(c(CCC(=O)O)c1C)/C=c1\[nH]/c(c(C)c1CCC(=O)O)=C\C1=C(C)C(C)[C@@]2(C)N1 |
| InChI | InChI=1S/C33H42N4O4/c1-16-20(5)32(7)33(8)21(6)17(2)27(37-33)14-25-19(4)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)18(3)24(34-28)13-26(16)36-32/h13-15,20,34-37H,9-12H2,1-8H3,(H,38,39)(H,40,41)/b24-13-,27-14-,28-15-/t20?,32-,33-/m1/s1 |
| InChIKey | UNMVQFDQMRVBFG-ACYVJLEOSA-N |
| XLogP | 3.93 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |