C34H38N4O4S2 — CID 164890054
3-[(1Z,4Z,8E,9Z,13S,14Z)-18-(2-carboxyethyl)-3,3',7,12,17-pentamethyl-8-(1-sulfanylethylidene)spiro[21,22,23,24-tetrahydroporphyrin-13,2'-thiirane]-2-yl]propanoic acid (PubChem CID 164890054) has the molecular formula C34H38N4O4S2 and a molecular weight of 630.84 g/mol. Its IUPAC name is 3-[(1Z,4Z,8E,9Z,13S,14Z)-18-(2-carboxyethyl)-3,3',7,12,17-pentamethyl-8-(1-sulfanylethylidene)spiro[21,22,23,24-tetrahydroporphyrin-13,2'-thiirane]-2-yl]propanoic acid.
| Compound Name | 3-[(1Z,4Z,8E,9Z,13S,14Z)-18-(2-carboxyethyl)-3,3',7,12,17-pentamethyl-8-(1-sulfanylethylidene)spiro[21,22,23,24-tetrahydroporphyrin-13,2'-thiirane]-2-yl]propanoic acid |
|---|---|
| PubChem CID | 164890054 |
| Molecular Formula | C34H38N4O4S2 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 3-[(1Z,4Z,8E,9Z,13S,14Z)-18-(2-carboxyethyl)-3,3',7,12,17-pentamethyl-8-(1-sulfanylethylidene)spiro[21,22,23,24-tetrahydroporphyrin-13,2'-thiirane]-2-yl]propanoic acid |
| SMILES | CC1=C2/C=c3/[nH]c(c(C)/c3=C(/C)S)/C=c3\[nH]/c(c(CCC(=O)O)c3C)=C\c3[nH]c(c(C)c3CCC(=O)O)/C=C(\N2)[C@@]12SC2C |
| InChI | InChI=1S/C34H38N4O4S2/c1-15-21(7-9-31(39)40)27-13-28-22(8-10-32(41)42)16(2)25(36-28)14-30-34(20(6)44-34)18(4)26(38-30)12-29-33(19(5)43)17(3)24(37-29)11-23(15)35-27/h11-14,20,35-38,43H,7-10H2,1-6H3,(H,39,40)(H,41,42)/b23-11-,27-13-,29-12+,30-14-,33-19+/t20?,34-/m1/s1 |
| InChIKey | PEZGKIZBVWEZDT-VOHACLSNSA-N |
| XLogP | 3.23 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|