C34H40N4O4S — CID 164890242
3-[(1Z,3'S,4Z,7S,10Z,14Z)-18-(2-carboxyethyl)-12-ethyl-3,3',8,13,17-pentamethylspiro[21,22,23,24-tetrahydro-6H-porphyrin-7,2'-thiirane]-2-yl]propanoic acid (PubChem CID 164890242) has the molecular formula C34H40N4O4S and a molecular weight of 600.79 g/mol. Its IUPAC name is 3-[(1Z,3'S,4Z,7S,10Z,14Z)-18-(2-carboxyethyl)-12-ethyl-3,3',8,13,17-pentamethylspiro[21,22,23,24-tetrahydro-6H-porphyrin-7,2'-thiirane]-2-yl]propanoic acid.
| Compound Name | 3-[(1Z,3'S,4Z,7S,10Z,14Z)-18-(2-carboxyethyl)-12-ethyl-3,3',8,13,17-pentamethylspiro[21,22,23,24-tetrahydro-6H-porphyrin-7,2'-thiirane]-2-yl]propanoic acid |
|---|---|
| PubChem CID | 164890242 |
| Molecular Formula | C34H40N4O4S |
| Molecular Weight | 600.79 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 3-[(1Z,3'S,4Z,7S,10Z,14Z)-18-(2-carboxyethyl)-12-ethyl-3,3',8,13,17-pentamethylspiro[21,22,23,24-tetrahydro-6H-porphyrin-7,2'-thiirane]-2-yl]propanoic acid |
| SMILES | CCc1c(C)/c2[nH]/c1=C/C1=C(C)[C@]3(S[C@H]3C)C(/C=c3/[nH]/c(c(CCC(=O)O)c3C)=C/c3[nH]c(c(C)c3CCC(=O)O)\C=2)N1 |
| InChI | InChI=1S/C34H40N4O4S/c1-7-21-16(2)24-12-25-17(3)22(8-10-32(39)40)29(36-25)14-30-23(9-11-33(41)42)18(4)26(37-30)15-31-34(20(6)43-34)19(5)27(38-31)13-28(21)35-24/h12-15,20,31,35-38H,7-11H2,1-6H3,(H,39,40)(H,41,42)/b24-12-,26-15-,28-13+,30-14+/t20-,31?,34+/m0/s1 |
| InChIKey | BSVIQAHGCGQNCS-SZHPAMERSA-N |
| XLogP | 2.55 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.79 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|