C43H50N4O — CID 137283963
[4-(13,17-dibutyl-2,8-diethyl-3,7,12,18-tetramethyl-23H-porphyrin-5-ylidene)cyclohexa-2,5-dien-1-ylidene]methanol (PubChem CID 137283963) has the molecular formula C43H50N4O and a molecular weight of 638.90 g/mol. Its IUPAC name is [4-(13,17-dibutyl-2,8-diethyl-3,7,12,18-tetramethyl-23H-porphyrin-5-ylidene)cyclohexa-2,5-dien-1-ylidene]methanol.
| Compound Name | [4-(13,17-dibutyl-2,8-diethyl-3,7,12,18-tetramethyl-23H-porphyrin-5-ylidene)cyclohexa-2,5-dien-1-ylidene]methanol |
|---|---|
| PubChem CID | 137283963 |
| Molecular Formula | C43H50N4O |
| Molecular Weight | 638.90 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | [4-(13,17-dibutyl-2,8-diethyl-3,7,12,18-tetramethyl-23H-porphyrin-5-ylidene)cyclohexa-2,5-dien-1-ylidene]methanol |
| SMILES | CCCCC1=C(C)C2=N/C1=C\c1[nH]c(c(C)c1CCCC)/C=C1\N=C(C(C)=C1CC)C(=c1ccc(=CO)cc1)C1=N/C(=C\2)C(CC)=C1C |
| InChI | InChI=1S/C43H50N4O/c1-9-13-15-33-25(5)35-21-37-31(11-3)27(7)42(46-37)41(30-19-17-29(24-48)18-20-30)43-28(8)32(12-4)38(47-43)22-36-26(6)34(16-14-10-2)40(45-36)23-39(33)44-35/h17-24,44,48H,9-16H2,1-8H3/b29-24-,37-21-,38-22-,40-23-,41-30- |
| InChIKey | DXQXLMNODGSHNG-GDIBOZCQSA-N |
| XLogP | 9.72 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.90 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |