C40H45N5O5 — CID 173332723
3-[10-(6-amino-1-hydroxyhexylidene)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid (PubChem CID 173332723) has the molecular formula C40H45N5O5 and a molecular weight of 675.83 g/mol. Its IUPAC name is 3-[10-(6-amino-1-hydroxyhexylidene)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[10-(6-amino-1-hydroxyhexylidene)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 173332723 |
| Molecular Formula | C40H45N5O5 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.34 |
| IUPAC Name | 3-[10-(6-amino-1-hydroxyhexylidene)-18-(2-carboxyethyl)-7,12-bis(ethenyl)-3,8,13,17-tetramethyl-21H-porphyrin-2-yl]propanoic acid |
| SMILES | C=CC1=C(C)/C2=C/C3=N/C(=C\c4[nH]c(c(C)c4CCC(=O)O)/C=C4\N=C(C(C)=C4C=C)C(=C(O)CCCCCN)C1=N2)C(CCC(=O)O)=C3C |
| InChI | InChI=1S/C40H45N5O5/c1-7-25-24(6)39-38(35(46)12-10-9-11-17-41)40-26(8-2)21(3)31(44-40)18-29-22(4)27(13-15-36(47)48)33(42-29)20-34-28(14-16-37(49)50)23(5)30(43-34)19-32(25)45-39/h7-8,18-20,43,46H,1-2,9-17,41H2,3-6H3,(H,47,48)(H,49,50)/b31-18-,32-19-,33-20-,38-35? |
| InChIKey | SIEMYWHLVPXTML-DQBOESKISA-N |
| XLogP | 7.80 |
| TPSA | 173.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|