C38H40N4O6 — CID 163121799
methyl 3-[8-ethenyl-13,18-bis(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-2-yl]propanoate (PubChem CID 163121799) has the molecular formula C38H40N4O6 and a molecular weight of 648.76 g/mol. Its IUPAC name is methyl 3-[8-ethenyl-13,18-bis(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8-ethenyl-13,18-bis(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 163121799 |
| Molecular Formula | C38H40N4O6 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | methyl 3-[8-ethenyl-13,18-bis(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethylporphyrin-2-yl]propanoate |
| SMILES | C=CC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C(C)=C4CCC(=O)OC)C(CCC(=O)OC)=C3C)C(CCC(=O)OC)=C1C |
| InChI | InChI=1S/C38H40N4O6/c1-9-24-20(2)28-16-29-21(3)26(11-14-37(44)47-7)34(40-29)19-35-27(12-15-38(45)48-8)23(5)31(42-35)18-33-25(10-13-36(43)46-6)22(4)30(41-33)17-32(24)39-28/h9,16-19H,1,10-15H2,2-8H3/b28-16-,29-16-,30-17-,31-18-,32-17-,33-18-,34-19-,35-19- |
| InChIKey | BUCJDGRMOLXRGL-ISRSUVRUSA-N |
| XLogP | 6.67 |
| TPSA | 128.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|