C42H46N4O10 — CID 163168511
methyl 3-[13-(2-methoxy-2-oxoethyl)-8,12,17-tris(3-methoxy-3-oxopropyl)-3,7,18-trimethylporphyrin-2-yl]propanoate (PubChem CID 163168511) has the molecular formula C42H46N4O10 and a molecular weight of 766.85 g/mol. Its IUPAC name is methyl 3-[13-(2-methoxy-2-oxoethyl)-8,12,17-tris(3-methoxy-3-oxopropyl)-3,7,18-trimethylporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[13-(2-methoxy-2-oxoethyl)-8,12,17-tris(3-methoxy-3-oxopropyl)-3,7,18-trimethylporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 163168511 |
| Molecular Formula | C42H46N4O10 |
| Molecular Weight | 766.85 g/mol |
| Exact Mass | 766.32 |
| IUPAC Name | methyl 3-[13-(2-methoxy-2-oxoethyl)-8,12,17-tris(3-methoxy-3-oxopropyl)-3,7,18-trimethylporphyrin-2-yl]propanoate |
| SMILES | COC(=O)CCC1=C(C)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C(C)=C5CCC(=O)OC)C(CC(=O)OC)=C4CCC(=O)OC)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C42H46N4O10/c1-22-25(9-13-38(47)52-4)33-19-32-24(3)27(11-15-40(49)54-6)35(45-32)21-37-29(17-42(51)56-8)28(12-16-41(50)55-7)36(46-37)20-34-26(10-14-39(48)53-5)23(2)31(44-34)18-30(22)43-33/h18-21H,9-17H2,1-8H3/b30-18-,31-18-,32-19-,33-19-,34-20-,35-21-,36-20-,37-21- |
| InChIKey | UJWPVVKBDJVSIU-YLOIPWEJSA-N |
| XLogP | 5.98 |
| TPSA | 180.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.85 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|