C37H42N4O5 — CID 135405154
methyl 3-[8,13-diethyl-20-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate (PubChem CID 135405154) has the molecular formula C37H42N4O5 and a molecular weight of 622.77 g/mol. Its IUPAC name is methyl 3-[8,13-diethyl-20-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[8,13-diethyl-20-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 135405154 |
| Molecular Formula | C37H42N4O5 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | methyl 3-[8,13-diethyl-20-(hydroxymethylidene)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22H-porphyrin-2-yl]propanoate |
| SMILES | CCC1=C(C)/C2=C/c3[nH]c(c(C)c3CC)/C=C3\N=C(C(=CO)C4=N/C(=C\C1=N2)C(C)=C4CCC(=O)OC)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C37H42N4O5/c1-9-23-19(3)28-15-30-21(5)25(11-13-34(43)45-7)36(40-30)27(18-42)37-26(12-14-35(44)46-8)22(6)31(41-37)17-33-24(10-2)20(4)29(39-33)16-32(23)38-28/h15-18,38,42H,9-14H2,1-8H3/b27-18?,29-16-,30-15-,31-17- |
| InChIKey | ZECOHBQEENUJDD-YNSDEKMOSA-N |
| XLogP | 7.54 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|