C32H36N4O3 — CID 174068039
methyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoate (PubChem CID 174068039) has the molecular formula C32H36N4O3 and a molecular weight of 524.67 g/mol. Its IUPAC name is methyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 174068039 |
| Molecular Formula | C32H36N4O3 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | methyl 3-[(2S,3S)-13-ethyl-8-(hydroxymethylidene)-3,7,12,17,20-pentamethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoate |
| SMILES | CCC1=C(C)/C2=C/C3=NC(=C(C)C3=CO)/C=C3\N/C(=C(/C)C4=N/C(=C\C1=N2)C(C)=C4)[C@@H](CCC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C32H36N4O3/c1-8-21-17(3)27-14-30-23(15-37)19(5)26(35-30)13-28-18(4)22(9-10-31(38)39-7)32(36-28)20(6)25-11-16(2)24(33-25)12-29(21)34-27/h11-15,18,22,36-37H,8-10H2,1-7H3/b23-15?,24-12-,27-14-,28-13-,32-20-/t18-,22-/m0/s1 |
| InChIKey | MGGKMQSMTSTIJL-IPOSMGMTSA-N |
| XLogP | 6.49 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|