C40H47N5O9 — CID 152764643
3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid (PubChem CID 152764643) has the molecular formula C40H47N5O9 and a molecular weight of 741.84 g/mol. Its IUPAC name is 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152764643 |
| Molecular Formula | C40H47N5O9 |
| Molecular Weight | 741.84 g/mol |
| Exact Mass | 741.34 |
| IUPAC Name | 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid |
| SMILES | CCC1=C(C)/C2=C/C3=NC(=C(C)C3=CO)/C=C3\N/C(=C(/CC(=O)OC)C4=N/C(=C\C1=N2)C(C)=C4C(=O)NCCOCCOC(C)=O)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C40H47N5O9/c1-8-25-20(2)30-17-34-28(19-46)22(4)29(43-34)16-31-21(3)26(9-10-35(48)49)38(44-31)27(15-36(50)52-7)39-37(23(5)32(45-39)18-33(25)42-30)40(51)41-11-12-53-13-14-54-24(6)47/h16-19,21,26,44,46H,8-15H2,1-7H3,(H,41,51)(H,48,49)/b28-19?,30-17-,31-16-,32-18-,38-27- |
| InChIKey | CKTUDCVKLQKEEO-ZMXLCCJESA-N |
| XLogP | 5.01 |
| TPSA | 197.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.84 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|