C40H49N5O9 — CID 152764645
3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 152764645) has the molecular formula C40H49N5O9 and a molecular weight of 743.86 g/mol. Its IUPAC name is 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152764645 |
| Molecular Formula | C40H49N5O9 |
| Molecular Weight | 743.86 g/mol |
| Exact Mass | 743.35 |
| IUPAC Name | 3-[18-[2-(2-acetyloxyethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)NCCOCCOC(C)=O)C(CCC(=O)O)C4C)c(C)c3CO |
| InChI | InChI=1S/C40H49N5O9/c1-8-25-20(2)30-17-34-28(19-46)22(4)29(43-34)16-31-21(3)26(9-10-35(48)49)38(44-31)27(15-36(50)52-7)39-37(23(5)32(45-39)18-33(25)42-30)40(51)41-11-12-53-13-14-54-24(6)47/h16-18,21,26,42-43,46H,8-15,19H2,1-7H3,(H,41,51)(H,48,49)/b29-16-,30-17-,31-16-,32-18-,33-18-,34-17-,38-27-,39-27- |
| InChIKey | DLUKASTXXOGEAN-JOIJRGJRSA-N |
| XLogP | 5.08 |
| TPSA | 205.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.86 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|