C38H47N5O6 — CID 152763753
3-[8,13-diethyl-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 152763753) has the molecular formula C38H47N5O6 and a molecular weight of 669.82 g/mol. Its IUPAC name is 3-[8,13-diethyl-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[8,13-diethyl-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152763753 |
| Molecular Formula | C38H47N5O6 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | 3-[8,13-diethyl-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)NCCCO)C(CCC(=O)O)C4C)c(C)c3CC |
| InChI | InChI=1S/C38H47N5O6/c1-8-23-19(3)27-16-29-21(5)25(11-12-33(45)46)36(42-29)26(15-34(47)49-7)37-35(38(48)39-13-10-14-44)22(6)30(43-37)18-32-24(9-2)20(4)28(41-32)17-31(23)40-27/h16-18,21,25,40-41,44H,8-15H2,1-7H3,(H,39,48)(H,45,46)/b27-16-,28-17-,29-16-,30-18-,31-17-,32-18-,36-26-,37-26- |
| InChIKey | PLTVSLGIEIGBOM-ZDGGHJJRSA-N |
| XLogP | 5.95 |
| TPSA | 170.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|