C38H48N6O4 — CID 131737897
12-ethenyl-7-ethyl-20-(2-hydroxyethyl)-N-(3-hydroxypropyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-17,18,22,23-tetrahydroporphyrin-2-carboxamide (PubChem CID 131737897) has the molecular formula C38H48N6O4 and a molecular weight of 652.84 g/mol. Its IUPAC name is 12-ethenyl-7-ethyl-20-(2-hydroxyethyl)-N-(3-hydroxypropyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-17,18,22,23-tetrahydroporphyrin-2-carboxamide.
| Compound Name | 12-ethenyl-7-ethyl-20-(2-hydroxyethyl)-N-(3-hydroxypropyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-17,18,22,23-tetrahydroporphyrin-2-carboxamide |
|---|---|
| PubChem CID | 131737897 |
| Molecular Formula | C38H48N6O4 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | 12-ethenyl-7-ethyl-20-(2-hydroxyethyl)-N-(3-hydroxypropyl)-3,8,13,17-tetramethyl-18-[3-(methylamino)-3-oxopropyl]-17,18,22,23-tetrahydroporphyrin-2-carboxamide |
| SMILES | C=Cc1c(C)c2cc3nc(c(CCO)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)NCCCO)C(CCC(=O)NC)C3C |
| InChI | InChI=1S/C38H48N6O4/c1-8-24-20(3)28-17-30-22(5)26(11-12-34(47)39-7)36(43-30)27(13-16-46)37-35(38(48)40-14-10-15-45)23(6)31(44-37)19-33-25(9-2)21(4)29(42-33)18-32(24)41-28/h8,17-19,22,26,41-42,45-46H,1,9-16H2,2-7H3,(H,39,47)(H,40,48)/b28-17-,29-18-,30-17-,31-19-,32-18-,33-19-,36-27-,37-27- |
| InChIKey | ZMARBYADZDFAQR-OXKXRVMNSA-N |
| XLogP | 5.51 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|