C35H40N4O5 — CID 59037510
methyl (17S,18S)-12-ethenyl-7-ethyl-18-(2-hydroxyethyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 59037510) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is methyl (17S,18S)-12-ethenyl-7-ethyl-18-(2-hydroxyethyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl (17S,18S)-12-ethenyl-7-ethyl-18-(2-hydroxyethyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 59037510 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | methyl (17S,18S)-12-ethenyl-7-ethyl-18-(2-hydroxyethyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)[C@@H](CCO)[C@@H]3C |
| InChI | InChI=1S/C35H40N4O5/c1-9-21-17(3)25-14-27-19(5)23(11-12-40)33(38-27)24(13-31(41)43-7)34-32(35(42)44-8)20(6)28(39-34)16-30-22(10-2)18(4)26(37-30)15-29(21)36-25/h9,14-16,19,23,36-37,40H,1,10-13H2,2-8H3/b25-14-,26-15-,27-14-,28-16-,29-15-,30-16-,33-24-,34-24-/t19-,23-/m0/s1 |
| InChIKey | LXJWSIRUQRWGBB-QIDUWSHBSA-N |
| XLogP | 6.23 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |