C37H40N4O6 — CID 154658401
methyl (17S,18E)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropylidene)-3,8,13,17-tetramethyl-22,23-dihydro-17H-porphyrin-2-carboxylate (PubChem CID 154658401) has the molecular formula C37H40N4O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is methyl (17S,18E)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropylidene)-3,8,13,17-tetramethyl-22,23-dihydro-17H-porphyrin-2-carboxylate.
| Compound Name | methyl (17S,18E)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropylidene)-3,8,13,17-tetramethyl-22,23-dihydro-17H-porphyrin-2-carboxylate |
|---|---|
| PubChem CID | 154658401 |
| Molecular Formula | C37H40N4O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | methyl (17S,18E)-12-ethenyl-7-ethyl-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropylidene)-3,8,13,17-tetramethyl-22,23-dihydro-17H-porphyrin-2-carboxylate |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)/C(=C/CC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C37H40N4O6/c1-10-22-18(3)26-15-28-20(5)24(12-13-32(42)45-7)35(40-28)25(14-33(43)46-8)36-34(37(44)47-9)21(6)29(41-36)17-31-23(11-2)19(4)27(39-31)16-30(22)38-26/h10,12,15-17,20,38-39H,1,11,13-14H2,2-9H3/b24-12+,26-15-,27-16-,28-15-,29-17-,30-16-,31-17-,35-25-,36-25-/t20-/m0/s1 |
| InChIKey | RUTOKFVUCGRVCF-RFFQEEPWSA-N |
| XLogP | 6.71 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|