C37H43N5O5 — CID 10722762
methyl (2S,3S)-17-ethenyl-12-ethyl-7-(ethylcarbamoyl)-3-(3-methoxy-3-oxopropyl)-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-carboxylate (PubChem CID 10722762) has the molecular formula C37H43N5O5 and a molecular weight of 637.78 g/mol. Its IUPAC name is methyl (2S,3S)-17-ethenyl-12-ethyl-7-(ethylcarbamoyl)-3-(3-methoxy-3-oxopropyl)-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-carboxylate.
| Compound Name | methyl (2S,3S)-17-ethenyl-12-ethyl-7-(ethylcarbamoyl)-3-(3-methoxy-3-oxopropyl)-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-carboxylate |
|---|---|
| PubChem CID | 10722762 |
| Molecular Formula | C37H43N5O5 |
| Molecular Weight | 637.78 g/mol |
| Exact Mass | 637.33 |
| IUPAC Name | methyl (2S,3S)-17-ethenyl-12-ethyl-7-(ethylcarbamoyl)-3-(3-methoxy-3-oxopropyl)-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-carboxylate |
| SMILES | C=Cc1c(C)c2cc3nc(c(C(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)NCC)[C@@H](CCC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C37H43N5O5/c1-10-22-18(4)25-15-27-20(6)24(13-14-31(43)46-8)34(41-27)33(37(45)47-9)35-32(36(44)38-12-3)21(7)28(42-35)17-30-23(11-2)19(5)26(40-30)16-29(22)39-25/h10,15-17,20,24,39-40H,1,11-14H2,2-9H3,(H,38,44)/b25-15-,26-16-,27-15-,28-17-,29-16-,30-17-,34-33+,35-33+/t20-,24-/m0/s1 |
| InChIKey | JGZOKMYDYAOSLB-GKZSTZTHSA-N |
| XLogP | 6.83 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |