C37H44N4O4 — CID 59984365
methyl 2-[17-ethenyl-12-ethyl-3-(3-methoxy-3-oxopropyl)-2,7,8,13,18-pentamethyl-2,3,23,24-tetrahydroporphyrin-5-yl]propanoate (PubChem CID 59984365) has the molecular formula C37H44N4O4 and a molecular weight of 608.78 g/mol. Its IUPAC name is methyl 2-[17-ethenyl-12-ethyl-3-(3-methoxy-3-oxopropyl)-2,7,8,13,18-pentamethyl-2,3,23,24-tetrahydroporphyrin-5-yl]propanoate.
| Compound Name | methyl 2-[17-ethenyl-12-ethyl-3-(3-methoxy-3-oxopropyl)-2,7,8,13,18-pentamethyl-2,3,23,24-tetrahydroporphyrin-5-yl]propanoate |
|---|---|
| PubChem CID | 59984365 |
| Molecular Formula | C37H44N4O4 |
| Molecular Weight | 608.78 g/mol |
| Exact Mass | 608.34 |
| IUPAC Name | methyl 2-[17-ethenyl-12-ethyl-3-(3-methoxy-3-oxopropyl)-2,7,8,13,18-pentamethyl-2,3,23,24-tetrahydroporphyrin-5-yl]propanoate |
| SMILES | C=Cc1c(C)c2cc3nc(c(C(C)C(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C)C(CCC(=O)OC)C3C |
| InChI | InChI=1S/C37H44N4O4/c1-11-24-20(5)28-15-30-22(7)26(13-14-33(42)44-9)36(41-30)34(23(8)37(43)45-10)35-19(4)18(3)27(40-35)16-31-25(12-2)21(6)29(39-31)17-32(24)38-28/h11,15-17,22-23,26,38-39H,1,12-14H2,2-10H3/b27-16-,28-15-,29-17-,30-15-,31-16-,32-17-,35-34-,36-34- |
| InChIKey | FMYITYHQFJSOMR-SRBFEPRGSA-N |
| XLogP | 8.20 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.78 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |