C42H55N5O6 — CID 168897478
methyl 3-[(2S,3S)-8-ethenyl-13-ethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 168897478) has the molecular formula C42H55N5O6 and a molecular weight of 725.93 g/mol. Its IUPAC name is methyl 3-[(2S,3S)-8-ethenyl-13-ethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,3S)-8-ethenyl-13-ethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 168897478 |
| Molecular Formula | C42H55N5O6 |
| Molecular Weight | 725.93 g/mol |
| Exact Mass | 725.42 |
| IUPAC Name | methyl 3-[(2S,3S)-8-ethenyl-13-ethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)N(C)CCOCCOCCOC)[C@@H](CCC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C42H55N5O6/c1-11-29-24(3)32-21-34-26(5)31(13-14-38(48)51-10)40(45-34)28(7)41-39(42(49)47(8)15-16-52-19-20-53-18-17-50-9)27(6)35(46-41)23-37-30(12-2)25(4)33(44-37)22-36(29)43-32/h11,21-23,26,31,43-44H,1,12-20H2,2-10H3/b32-21-,33-22-,34-21-,35-23-,36-22-,37-23-,40-28-,41-28-/t26-,31-/m0/s1 |
| InChIKey | FEFAJECCBDYYDL-AKTLISOUSA-N |
| XLogP | 7.35 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.93 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|