C38H45N5O6 — CID 171648581
(18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-[2-methoxyethyl(methyl)amino]-2-oxoethyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 171648581) has the molecular formula C38H45N5O6 and a molecular weight of 667.81 g/mol. Its IUPAC name is (18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-[2-methoxyethyl(methyl)amino]-2-oxoethyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-[2-methoxyethyl(methyl)amino]-2-oxoethyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 171648581 |
| Molecular Formula | C38H45N5O6 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.34 |
| IUPAC Name | (18S)-18-(2-carboxyethyl)-12-ethenyl-7-ethyl-20-[2-[2-methoxyethyl(methyl)amino]-2-oxoethyl]-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)N(C)CCOC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)[C@@H](CCC(=O)O)C3C |
| InChI | InChI=1S/C38H45N5O6/c1-9-23-19(3)27-16-29-21(5)25(11-12-34(45)46)36(41-29)26(15-33(44)43(7)13-14-49-8)37-35(38(47)48)22(6)30(42-37)18-32-24(10-2)20(4)28(40-32)17-31(23)39-27/h9,16-18,21,25,39-40H,1,10-15H2,2-8H3,(H,45,46)(H,47,48)/b27-16-,28-17-,29-16-,30-18-,31-17-,32-18-,36-26-,37-26-/t21?,25-/m0/s1 |
| InChIKey | HARNNZAIDRQWOT-LAOMREBTSA-N |
| XLogP | 6.55 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |