C35H38N4O6 — CID 59972126
18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,5,8,13,17-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 59972126) has the molecular formula C35H38N4O6 and a molecular weight of 610.71 g/mol. Its IUPAC name is 18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,5,8,13,17-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | 18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,5,8,13,17-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 59972126 |
| Molecular Formula | C35H38N4O6 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 18-(2-carboxyethyl)-20-(carboxymethyl)-12-ethenyl-7-ethyl-3,5,8,13,17-pentamethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)O)c4nc(c(C)c5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C35H38N4O6/c1-8-20-15(3)24-13-25-17(5)22(10-11-28(40)41)33(38-25)23(12-29(42)43)34-30(35(44)45)18(6)31(39-34)19(7)32-21(9-2)16(4)26(37-32)14-27(20)36-24/h8,13-14,17,22,36-37H,1,9-12H2,2-7H3,(H,40,41)(H,42,43)(H,44,45)/b24-13-,25-13-,26-14-,27-14-,31-19-,32-19-,33-23-,34-23- |
| InChIKey | ZALHTMZLLWDYBA-HCVUXFFJSA-N |
| XLogP | 6.84 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |