C34H42N4O2 — CID 168897628
ethane;3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 168897628) has the molecular formula C34H42N4O2 and a molecular weight of 538.74 g/mol. Its IUPAC name is ethane;3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | ethane;3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 168897628 |
| Molecular Formula | C34H42N4O2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | ethane;3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCC(=O)O)[C@@H]3C.CC |
| InChI | InChI=1S/C32H36N4O2.C2H6/c1-8-21-18(5)27-15-30-22(9-2)17(4)26(34-30)14-28-19(6)23(10-11-31(37)38)32(36-28)20(7)25-12-16(3)24(33-25)13-29(21)35-27;1-2/h9,12-15,19,23,34-35H,2,8,10-11H2,1,3-7H3,(H,37,38);1-2H3/b24-13-,25-20-,26-14-,27-15-,28-14-,29-13-,30-15-,32-20-;/t19-,23-;/m0./s1 |
| InChIKey | JAGWXRDCACBBQD-PTFOEAINSA-N |
| XLogP | 8.78 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |