C36H44ClN5O — CID 174010055
N-(3-chloropropyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide (PubChem CID 174010055) has the molecular formula C36H44ClN5O and a molecular weight of 598.24 g/mol. Its IUPAC name is N-(3-chloropropyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide.
| Compound Name | N-(3-chloropropyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 174010055 |
| Molecular Formula | C36H44ClN5O |
| Molecular Weight | 598.24 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | N-(3-chloropropyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCC(=O)N(C)CCCCl)[C@@H]3C |
| InChI | InChI=1S/C36H44ClN5O/c1-9-25-22(5)31-19-34-26(10-2)21(4)30(39-34)18-32-23(6)27(12-13-35(43)42(8)15-11-14-37)36(41-32)24(7)29-16-20(3)28(38-29)17-33(25)40-31/h10,16-19,23,27,39-40H,2,9,11-15H2,1,3-8H3/b28-17-,29-24-,30-18-,31-19-,32-18-,33-17-,34-19-,36-24-/t23-,27-/m0/s1 |
| InChIKey | YTDCMPUDRQIHFC-PDGFSDPKSA-N |
| XLogP | 8.76 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.24 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|