C33H40N4O2 — CID 174067364
4-[(3S)-8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]butanoic acid (PubChem CID 174067364) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-[(3S)-8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]butanoic acid.
| Compound Name | 4-[(3S)-8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]butanoic acid |
|---|---|
| PubChem CID | 174067364 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 4-[(3S)-8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]butanoic acid |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5)C(CCCC(=O)O)[C@@H]4C)c(C)c3CC |
| InChI | InChI=1S/C33H40N4O2/c1-8-22-19(5)28-16-31-23(9-2)18(4)27(35-31)15-29-20(6)24(11-10-12-32(38)39)33(37-29)21(7)26-13-17(3)25(34-26)14-30(22)36-28/h13-16,20,24,35-36H,8-12H2,1-7H3,(H,38,39)/b25-14-,26-21-,27-15-,28-16-,29-15-,30-14-,31-16-,33-21-/t20-,24?/m0/s1 |
| InChIKey | QULAPSNTFZDBRX-STKFOOLESA-N |
| XLogP | 8.07 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |