C32H38N4 — CID 171647998
(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2-propyl-2,3,22,23-tetrahydroporphyrin (PubChem CID 171647998) has the molecular formula C32H38N4 and a molecular weight of 478.68 g/mol. Its IUPAC name is (2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2-propyl-2,3,22,23-tetrahydroporphyrin.
| Compound Name | (2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2-propyl-2,3,22,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 171647998 |
| Molecular Formula | C32H38N4 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2-propyl-2,3,22,23-tetrahydroporphyrin |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCC)[C@@H]3C |
| InChI | InChI=1S/C32H38N4/c1-9-12-24-20(7)29-15-27-18(5)23(11-3)31(34-27)16-28-19(6)22(10-2)30(35-28)14-25-17(4)13-26(33-25)21(8)32(24)36-29/h11,13-16,20,24,34-35H,3,9-10,12H2,1-2,4-8H3/b25-14-,26-21-,27-15-,28-16-,29-15-,30-14-,31-16-,32-21-/t20-,24-/m0/s1 |
| InChIKey | KQIKTPLCXDYKNY-DXFHMFOXSA-N |
| XLogP | 8.69 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |