C31H38N4O — CID 168897356
13-ethyl-8-(methoxymethyl)-7,12,17,20-tetramethyl-2-propyl-2,3,22,23-tetrahydroporphyrin (PubChem CID 168897356) has the molecular formula C31H38N4O and a molecular weight of 482.67 g/mol. Its IUPAC name is 13-ethyl-8-(methoxymethyl)-7,12,17,20-tetramethyl-2-propyl-2,3,22,23-tetrahydroporphyrin.
| Compound Name | 13-ethyl-8-(methoxymethyl)-7,12,17,20-tetramethyl-2-propyl-2,3,22,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 168897356 |
| Molecular Formula | C31H38N4O |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 13-ethyl-8-(methoxymethyl)-7,12,17,20-tetramethyl-2-propyl-2,3,22,23-tetrahydroporphyrin |
| SMILES | CCCC1Cc2cc3[nH]c(cc4[nH]c(cc5nc(c(C)c1n2)C=C5C)c(CC)c4C)c(COC)c3C |
| InChI | InChI=1S/C31H38N4O/c1-8-10-21-12-22-13-27-19(5)24(16-36-7)30(34-27)15-28-18(4)23(9-2)29(35-28)14-25-17(3)11-26(33-25)20(6)31(21)32-22/h11,13-15,21,34-35H,8-10,12,16H2,1-7H3/b22-13-,25-14-,26-20-,27-13-,28-15-,29-14-,30-15-,31-20- |
| InChIKey | REPAHBGZIAPRAR-KKKLJTOQSA-N |
| XLogP | 7.64 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |