C33H42N4O2 — CID 168897602
8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin;methyl propanoate (PubChem CID 168897602) has the molecular formula C33H42N4O2 and a molecular weight of 526.73 g/mol. Its IUPAC name is 8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin;methyl propanoate.
| Compound Name | 8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin;methyl propanoate |
|---|---|
| PubChem CID | 168897602 |
| Molecular Formula | C33H42N4O2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | 8,13-diethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin;methyl propanoate |
| SMILES | CCC(=O)OC.CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5)CC4C)c(C)c3CC |
| InChI | InChI=1S/C29H34N4.C4H8O2/c1-8-20-18(6)27-14-29-21(9-2)17(5)26(32-29)12-22-15(3)10-24(30-22)19(7)25-11-16(4)23(31-25)13-28(20)33-27;1-3-4(5)6-2/h11-15,32-33H,8-10H2,1-7H3;3H2,1-2H3/b22-12-,23-13-,24-19-,25-19-,26-12-,27-14-,28-13-,29-14-; |
| InChIKey | XGNDLQCJCCGDHR-MMAYSNIXSA-N |
| XLogP | 7.84 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |