C34H38N4O6 — CID 171648546
20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid;propanoic acid (PubChem CID 171648546) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is 20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid;propanoic acid.
| Compound Name | 20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid;propanoic acid |
|---|---|
| PubChem CID | 171648546 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 20-(carboxymethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid;propanoic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)O)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)CC3C.CCC(=O)O |
| InChI | InChI=1S/C31H32N4O4.C3H6O2/c1-7-18-15(4)22-11-21-14(3)9-25(32-21)20(10-28(36)37)30-29(31(38)39)17(6)24(35-30)13-27-19(8-2)16(5)23(34-27)12-26(18)33-22;1-2-3(4)5/h7,11-14,33-34H,1,8-10H2,2-6H3,(H,36,37)(H,38,39);2H2,1H3,(H,4,5)/b21-11-,22-11-,23-12-,24-13-,25-20-,26-12-,27-13-,30-20-; |
| InChIKey | GHLAMEVBYIIIKU-SAVVFQJNSA-N |
| XLogP | 6.61 |
| TPSA | 169.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |