C39H49N6O5+ — CID 164708432
2-[[2-[(2S,3S)-7-carboxy-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-yl]acetyl]amino]ethyl-trimethylazanium (PubChem CID 164708432) has the molecular formula C39H49N6O5+ and a molecular weight of 681.86 g/mol. Its IUPAC name is 2-[[2-[(2S,3S)-7-carboxy-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-yl]acetyl]amino]ethyl-trimethylazanium.
| Compound Name | 2-[[2-[(2S,3S)-7-carboxy-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-yl]acetyl]amino]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 164708432 |
| Molecular Formula | C39H49N6O5+ |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.38 |
| IUPAC Name | 2-[[2-[(2S,3S)-7-carboxy-3-(2-carboxyethyl)-17-ethenyl-12-ethyl-2,8,13,18-tetramethyl-2,3,23,24-tetrahydroporphyrin-5-yl]acetyl]amino]ethyl-trimethylazanium |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)NCC[N+](C)(C)C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)[C@@H](CCC(=O)O)[C@@H]3C |
| InChI | InChI=1S/C39H48N6O5/c1-10-24-20(3)28-17-30-22(5)26(12-13-35(47)48)37(43-30)27(16-34(46)40-14-15-45(7,8)9)38-36(39(49)50)23(6)31(44-38)19-33-25(11-2)21(4)29(42-33)18-32(24)41-28/h10,17-19,22,26H,1,11-16H2,2-9H3,(H4-,40,41,42,43,44,46,47,48,49,50)/p+1/t22-,26-/m0/s1 |
| InChIKey | DUBKOZOUPYGSHE-NVQXNPDNSA-O |
| XLogP | 6.27 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|