C36H40N4O6 — CID 159420376
(17S,18S)-12-ethenyl-7-ethyl-18-(3-formyloxypropyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 159420376) has the molecular formula C36H40N4O6 and a molecular weight of 624.74 g/mol. Its IUPAC name is (17S,18S)-12-ethenyl-7-ethyl-18-(3-formyloxypropyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-12-ethenyl-7-ethyl-18-(3-formyloxypropyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 159420376 |
| Molecular Formula | C36H40N4O6 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | (17S,18S)-12-ethenyl-7-ethyl-18-(3-formyloxypropyl)-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)[C@@H](CCCOC=O)[C@@H]3C |
| InChI | InChI=1S/C36H40N4O6/c1-8-22-18(3)26-14-28-20(5)24(11-10-12-46-17-41)34(39-28)25(13-32(42)45-7)35-33(36(43)44)21(6)29(40-35)16-31-23(9-2)19(4)27(38-31)15-30(22)37-26/h8,14-17,20,24,37-38H,1,9-13H2,2-7H3,(H,43,44)/b26-14-,27-15-,28-14-,29-16-,30-15-,31-16-,34-25-,35-25-/t20-,24-/m0/s1 |
| InChIKey | MHCXHSKUDZBXHE-WMYRYSOLSA-N |
| XLogP | 6.71 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|