C41H51N5O5 — CID 10747223
(17S,18S)-12-ethenyl-7-ethyl-20-(heptylcarbamoyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 10747223) has the molecular formula C41H51N5O5 and a molecular weight of 693.89 g/mol. Its IUPAC name is (17S,18S)-12-ethenyl-7-ethyl-20-(heptylcarbamoyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | (17S,18S)-12-ethenyl-7-ethyl-20-(heptylcarbamoyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 10747223 |
| Molecular Formula | C41H51N5O5 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.39 |
| IUPAC Name | (17S,18S)-12-ethenyl-7-ethyl-20-(heptylcarbamoyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(C(=O)NCCCCCCC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)[C@@H](CCC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C41H51N5O5/c1-9-12-13-14-15-18-42-40(48)37-38-28(16-17-35(47)51-8)24(6)31(45-38)19-29-22(4)26(10-2)33(43-29)20-30-23(5)27(11-3)34(44-30)21-32-25(7)36(41(49)50)39(37)46-32/h10,19-21,24,28,43-44H,2,9,11-18H2,1,3-8H3,(H,42,48)(H,49,50)/b29-19-,30-20-,31-19-,32-21-,33-20-,34-21-,38-37+,39-37+/t24-,28-/m0/s1 |
| InChIKey | VZPUEBINDQPMMJ-QUGVGIPHSA-N |
| XLogP | 8.69 |
| TPSA | 150.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|