C39H48N6O5 — CID 165055352
18-(2-carboxyethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-20-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid (PubChem CID 165055352) has the molecular formula C39H48N6O5 and a molecular weight of 680.85 g/mol. Its IUPAC name is 18-(2-carboxyethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-20-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid.
| Compound Name | 18-(2-carboxyethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-20-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
|---|---|
| PubChem CID | 165055352 |
| Molecular Formula | C39H48N6O5 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.37 |
| IUPAC Name | 18-(2-carboxyethyl)-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-20-[2-oxo-2-[2-(propylamino)ethylamino]ethyl]-17,18,22,23-tetrahydroporphyrin-2-carboxylic acid |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)NCCNCCC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)O)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C39H48N6O5/c1-8-13-40-14-15-41-34(46)16-27-37-26(11-12-35(47)48)22(6)30(44-37)17-28-20(4)24(9-2)32(42-28)18-29-21(5)25(10-3)33(43-29)19-31-23(7)36(39(49)50)38(27)45-31/h9,17-19,22,26,40,42-43H,2,8,10-16H2,1,3-7H3,(H,41,46)(H,47,48)(H,49,50)/b28-17-,29-18-,30-17-,31-19-,32-18-,33-19-,37-27-,38-27- |
| InChIKey | XFAPOUXFZPPDKF-XQPXWEERSA-N |
| XLogP | 6.56 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|