C38H51N5O6 — CID 171648571
2-(12-ethyl-2,7,8,13,17,18-hexamethyl-2,3,23,24-tetrahydroporphyrin-5-yl)-N-(2-methoxyethyl)-N-methylacetamide;formic acid;propanoic acid (PubChem CID 171648571) has the molecular formula C38H51N5O6 and a molecular weight of 673.86 g/mol. Its IUPAC name is 2-(12-ethyl-2,7,8,13,17,18-hexamethyl-2,3,23,24-tetrahydroporphyrin-5-yl)-N-(2-methoxyethyl)-N-methylacetamide;formic acid;propanoic acid.
| Compound Name | 2-(12-ethyl-2,7,8,13,17,18-hexamethyl-2,3,23,24-tetrahydroporphyrin-5-yl)-N-(2-methoxyethyl)-N-methylacetamide;formic acid;propanoic acid |
|---|---|
| PubChem CID | 171648571 |
| Molecular Formula | C38H51N5O6 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | 2-(12-ethyl-2,7,8,13,17,18-hexamethyl-2,3,23,24-tetrahydroporphyrin-5-yl)-N-(2-methoxyethyl)-N-methylacetamide;formic acid;propanoic acid |
| SMILES | CCC(=O)O.CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)N(C)CCOC)c5nc(cc1[nH]2)C(C)=C5C)CC4C)c(C)c3C.O=CO |
| InChI | InChI=1S/C34H43N5O2.C3H6O2.CH2O2/c1-10-24-23(7)30-16-28-20(4)19(3)27(36-28)15-26-18(2)13-31(35-26)25(14-33(40)39(8)11-12-41-9)34-22(6)21(5)29(38-34)17-32(24)37-30;1-2-3(4)5;2-1-3/h15-18,36-37H,10-14H2,1-9H3;2H2,1H3,(H,4,5);1H,(H,2,3)/b26-15-,27-15-,28-16-,29-17-,30-16-,31-25-,32-17-,34-25-;; |
| InChIKey | MFPVROZKHCEAMM-GFEHVPAASA-N |
| XLogP | 6.93 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|