C42H57N5O6 — CID 174108947
methyl 3-[(2S,3S)-8,13-diethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate (PubChem CID 174108947) has the molecular formula C42H57N5O6 and a molecular weight of 727.95 g/mol. Its IUPAC name is methyl 3-[(2S,3S)-8,13-diethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,3S)-8,13-diethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate |
|---|---|
| PubChem CID | 174108947 |
| Molecular Formula | C42H57N5O6 |
| Molecular Weight | 727.95 g/mol |
| Exact Mass | 727.43 |
| IUPAC Name | methyl 3-[(2S,3S)-8,13-diethyl-18-[2-[2-(2-methoxyethoxy)ethoxy]ethyl-methylcarbamoyl]-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5C(=O)N(C)CCOCCOCCOC)[C@@H](CCC(=O)OC)[C@@H]4C)c(C)c3CC |
| InChI | InChI=1S/C42H57N5O6/c1-11-29-24(3)32-21-34-26(5)31(13-14-38(48)51-10)40(45-34)28(7)41-39(42(49)47(8)15-16-52-19-20-53-18-17-50-9)27(6)35(46-41)23-37-30(12-2)25(4)33(44-37)22-36(29)43-32/h21-23,26,31,43-44H,11-20H2,1-10H3/b32-21-,33-22-,34-21-,35-23-,36-22-,37-23-,40-28-,41-28-/t26-,31-/m0/s1 |
| InChIKey | RGUCPDUGBWWMFB-AKTLISOUSA-N |
| XLogP | 7.27 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.95 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|