C43H56N4O7 — CID 10676487
methyl (17S,18S)-7-ethyl-12-(1-hexoxyethyl)-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 10676487) has the molecular formula C43H56N4O7 and a molecular weight of 740.94 g/mol. Its IUPAC name is methyl (17S,18S)-7-ethyl-12-(1-hexoxyethyl)-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl (17S,18S)-7-ethyl-12-(1-hexoxyethyl)-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 10676487 |
| Molecular Formula | C43H56N4O7 |
| Molecular Weight | 740.94 g/mol |
| Exact Mass | 740.41 |
| IUPAC Name | methyl (17S,18S)-7-ethyl-12-(1-hexoxyethyl)-20-(2-methoxy-2-oxoethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | CCCCCCOC(C)c1c(C)c2cc3nc(c(CC(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OC)[C@@H](CCC(=O)OC)[C@@H]3C |
| InChI | InChI=1S/C43H56N4O7/c1-11-13-14-15-18-54-27(7)39-25(5)33-20-32-24(4)29(16-17-37(48)51-8)41(46-32)30(19-38(49)52-9)42-40(43(50)53-10)26(6)34(47-42)21-35-28(12-2)23(3)31(44-35)22-36(39)45-33/h20-22,24,27,29,44-45H,11-19H2,1-10H3/b31-22-,32-20-,33-20-,34-21-,35-21-,36-22-,41-30-,42-30-/t24-,27?,29-/m0/s1 |
| InChIKey | VHCDUSLSTHBADL-KEXNBTBXSA-N |
| XLogP | 8.81 |
| TPSA | 145.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.94 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|