C37H45N5O7 — CID 152763762
3-[13-ethyl-8-(hydroxymethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 152763762) has the molecular formula C37H45N5O7 and a molecular weight of 671.79 g/mol. Its IUPAC name is 3-[13-ethyl-8-(hydroxymethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[13-ethyl-8-(hydroxymethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152763762 |
| Molecular Formula | C37H45N5O7 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | 3-[13-ethyl-8-(hydroxymethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)NCCCO)C(CCC(=O)O)C4C)c(C)c3CO |
| InChI | InChI=1S/C37H45N5O7/c1-7-22-18(2)27-15-31-25(17-44)20(4)26(40-31)14-28-19(3)23(9-10-32(45)46)35(41-28)24(13-33(47)49-6)36-34(37(48)38-11-8-12-43)21(5)29(42-36)16-30(22)39-27/h14-16,19,23,39-40,43-44H,7-13,17H2,1-6H3,(H,38,48)(H,45,46)/b26-14-,27-15-,28-14-,29-16-,30-16-,31-15-,35-24-,36-24- |
| InChIKey | FCNCJJHLTUHIDN-SDMFRPBCSA-N |
| XLogP | 4.88 |
| TPSA | 190.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|