C38H47N5O8 — CID 152765001
3-[13-ethyl-18-[2-(2-hydroxyethoxy)ethylcarbamoyl]-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 152765001) has the molecular formula C38H47N5O8 and a molecular weight of 701.82 g/mol. Its IUPAC name is 3-[13-ethyl-18-[2-(2-hydroxyethoxy)ethylcarbamoyl]-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[13-ethyl-18-[2-(2-hydroxyethoxy)ethylcarbamoyl]-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152765001 |
| Molecular Formula | C38H47N5O8 |
| Molecular Weight | 701.82 g/mol |
| Exact Mass | 701.34 |
| IUPAC Name | 3-[13-ethyl-18-[2-(2-hydroxyethoxy)ethylcarbamoyl]-8-(hydroxymethyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)NCCOCCO)C(CCC(=O)O)C4C)c(C)c3CO |
| InChI | InChI=1S/C38H47N5O8/c1-7-23-19(2)28-16-32-26(18-45)21(4)27(41-32)15-29-20(3)24(8-9-33(46)47)36(42-29)25(14-34(48)50-6)37-35(38(49)39-10-12-51-13-11-44)22(5)30(43-37)17-31(23)40-28/h15-17,20,24,40-41,44-45H,7-14,18H2,1-6H3,(H,39,49)(H,46,47)/b27-15-,28-16-,29-15-,30-17-,31-17-,32-16-,36-25-,37-25- |
| InChIKey | MPMQMFAGWQXJEX-MMKYDLSKSA-N |
| XLogP | 4.51 |
| TPSA | 199.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|