C45H61N5O7 — CID 152763755
3-[13-ethyl-8-(1-heptoxyethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid (PubChem CID 152763755) has the molecular formula C45H61N5O7 and a molecular weight of 784.01 g/mol. Its IUPAC name is 3-[13-ethyl-8-(1-heptoxyethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid.
| Compound Name | 3-[13-ethyl-8-(1-heptoxyethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152763755 |
| Molecular Formula | C45H61N5O7 |
| Molecular Weight | 784.01 g/mol |
| Exact Mass | 783.46 |
| IUPAC Name | 3-[13-ethyl-8-(1-heptoxyethyl)-18-(3-hydroxypropylcarbamoyl)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propanoic acid |
| SMILES | CCCCCCCOC(C)c1c(C)c2cc3nc(c(CC(=O)OC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)NCCCO)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C45H61N5O7/c1-9-11-12-13-14-20-57-29(7)41-27(5)35-22-34-26(4)31(16-17-39(52)53)43(49-34)32(21-40(54)56-8)44-42(45(55)46-18-15-19-51)28(6)36(50-44)23-37-30(10-2)25(3)33(47-37)24-38(41)48-35/h22-24,26,29,31,47-48,51H,9-21H2,1-8H3,(H,46,55)(H,52,53)/b33-24-,34-22-,35-22-,36-23-,37-23-,38-24-,43-32-,44-32- |
| InChIKey | WSDUZQVIHZAQLF-FMWPKQHVSA-N |
| XLogP | 8.44 |
| TPSA | 179.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.01 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|