C36H47N5O4 — CID 168897432
ethyl N-[(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)methyl]-N-methylcarbamate;methyl propanoate (PubChem CID 168897432) has the molecular formula C36H47N5O4 and a molecular weight of 613.80 g/mol. Its IUPAC name is ethyl N-[(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)methyl]-N-methylcarbamate;methyl propanoate.
| Compound Name | ethyl N-[(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)methyl]-N-methylcarbamate;methyl propanoate |
|---|---|
| PubChem CID | 168897432 |
| Molecular Formula | C36H47N5O4 |
| Molecular Weight | 613.80 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | ethyl N-[(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)methyl]-N-methylcarbamate;methyl propanoate |
| SMILES | CCC(=O)OC.CCOC(=O)N(C)Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)CC3C |
| InChI | InChI=1S/C32H39N5O2.C4H8O2/c1-9-22-19(5)29-15-31-23(16-37(8)32(38)39-10-2)20(6)28(36-31)13-24-17(3)11-26(33-24)21(7)27-12-18(4)25(34-27)14-30(22)35-29;1-3-4(5)6-2/h12-15,17,35-36H,9-11,16H2,1-8H3;3H2,1-2H3/b24-13-,25-14-,26-21-,27-21-,28-13-,29-15-,30-14-,31-15-; |
| InChIKey | IVBLDZUYIBTHRO-QFOUEZNVSA-N |
| XLogP | 7.87 |
| TPSA | 113.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.80 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |