C38H50N4O4S — CID 168897332
(6S)-2-[3-[1-(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)ethoxy]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 168897332) has the molecular formula C38H50N4O4S and a molecular weight of 658.91 g/mol. Its IUPAC name is (6S)-2-[3-[1-(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)ethoxy]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | (6S)-2-[3-[1-(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)ethoxy]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 168897332 |
| Molecular Formula | C38H50N4O4S |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | (6S)-2-[3-[1-(17-ethyl-3,7,10,13,18-pentamethyl-7,8,21,24-tetrahydroporphyrin-2-yl)ethoxy]propylsulfanyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5)CC4C)c(C)c3C(C)OCCCSC1CC(O)C[C@@H](CO)O1 |
| InChI | InChI=1S/C38H50N4O4S/c1-8-28-22(4)33-18-36-38(25(7)45-10-9-11-47-37-15-26(44)14-27(19-43)46-37)24(6)34(42-36)16-29-20(2)12-31(39-29)23(5)32-13-21(3)30(40-32)17-35(28)41-33/h13,16-18,20,25-27,37,41-44H,8-12,14-15,19H2,1-7H3/b29-16-,30-17-,31-23-,32-23-,33-18-,34-16-,35-17-,36-18-/t20?,25?,26?,27-,37?/m0/s1 |
| InChIKey | FLSSVJGDNCMCHS-ISKQUFCYSA-N |
| XLogP | 7.77 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|