C32H39BrN4O — CID 168897295
8-[1-(3-bromopropoxy)ethyl]-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin (PubChem CID 168897295) has the molecular formula C32H39BrN4O and a molecular weight of 575.60 g/mol. Its IUPAC name is 8-[1-(3-bromopropoxy)ethyl]-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin.
| Compound Name | 8-[1-(3-bromopropoxy)ethyl]-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin |
|---|---|
| PubChem CID | 168897295 |
| Molecular Formula | C32H39BrN4O |
| Molecular Weight | 575.60 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 8-[1-(3-bromopropoxy)ethyl]-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(C)c5nc(cc1[nH]2)C(C)=C5)CC4C)c(C)c3C(C)OCCCBr |
| InChI | InChI=1S/C32H39BrN4O/c1-8-23-19(4)28-16-31-32(22(7)38-11-9-10-33)21(6)29(37-31)14-24-17(2)12-26(34-24)20(5)27-13-18(3)25(35-27)15-30(23)36-28/h13-17,22,36-37H,8-12H2,1-7H3/b24-14-,25-15-,26-20-,27-20-,28-16-,29-14-,30-15-,31-16- |
| InChIKey | FHQWCOCDWVGQLJ-IMWOBYIOSA-N |
| XLogP | 8.57 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.60 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|