C33H39N5O4 — CID 171648599
methyl 7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-12-(methylaminomethyl)-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 171648599) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is methyl 7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-12-(methylaminomethyl)-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | methyl 7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-12-(methylaminomethyl)-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 171648599 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | methyl 7-ethyl-20-(2-methoxy-2-oxoethyl)-3,8,13,17-tetramethyl-12-(methylaminomethyl)-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | CCc1c(C)c2cc3[nH]c(cc4nc(c(CC(=O)OC)c5nc(cc1[nH]2)C(C)=C5C(=O)OC)CC4C)c(C)c3CNC |
| InChI | InChI=1S/C33H39N5O4/c1-9-20-17(3)25-13-29-22(15-34-6)18(4)24(37-29)12-23-16(2)10-27(35-23)21(11-30(39)41-7)32-31(33(40)42-8)19(5)26(38-32)14-28(20)36-25/h12-14,16,34,36-37H,9-11,15H2,1-8H3/b23-12-,24-12-,25-13-,26-14-,27-21-,28-14-,29-13-,32-21- |
| InChIKey | QFHCZAHNECJPHS-FEKCMIIOSA-N |
| XLogP | 5.38 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |