C38H47N5O3 — CID 171648588
ethyl 20-[2-[butyl(methyl)amino]-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate (PubChem CID 171648588) has the molecular formula C38H47N5O3 and a molecular weight of 621.83 g/mol. Its IUPAC name is ethyl 20-[2-[butyl(methyl)amino]-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate.
| Compound Name | ethyl 20-[2-[butyl(methyl)amino]-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
|---|---|
| PubChem CID | 171648588 |
| Molecular Formula | C38H47N5O3 |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.37 |
| IUPAC Name | ethyl 20-[2-[butyl(methyl)amino]-2-oxoethyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2-carboxylate |
| SMILES | C=Cc1c(C)c2cc3nc(c(CC(=O)N(C)CCCC)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4C(=O)OCC)CC3C |
| InChI | InChI=1S/C38H47N5O3/c1-10-14-15-43(9)35(44)17-27-32-16-21(5)28(39-32)18-29-22(6)25(11-2)33(40-29)19-30-23(7)26(12-3)34(41-30)20-31-24(8)36(37(27)42-31)38(45)46-13-4/h11,18-21,40-41H,2,10,12-17H2,1,3-9H3/b28-18-,29-18-,30-19-,31-20-,32-27-,33-19-,34-20-,37-27- |
| InChIKey | XVUQWCXSAUOMRK-PECZOZMISA-N |
| XLogP | 7.78 |
| TPSA | 103.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |