C34H42N4O3 — CID 177118124
3-[(2S,3S)-8-ethenyl-13-ethyl-20-(2-hydroxyethyl)-18-(hydroxymethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-ol (PubChem CID 177118124) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is 3-[(2S,3S)-8-ethenyl-13-ethyl-20-(2-hydroxyethyl)-18-(hydroxymethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-ol.
| Compound Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-20-(2-hydroxyethyl)-18-(hydroxymethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 177118124 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | 3-[(2S,3S)-8-ethenyl-13-ethyl-20-(2-hydroxyethyl)-18-(hydroxymethyl)-3,7,12,17-tetramethyl-2,3,22,23-tetrahydroporphyrin-2-yl]propan-1-ol |
| SMILES | C=Cc1c(C)c2cc3nc(c(CCO)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4CO)[C@@H](CCCO)[C@@H]3C |
| InChI | InChI=1S/C34H42N4O3/c1-7-22-18(3)27-14-29-20(5)24(10-9-12-39)33(37-29)25(11-13-40)34-26(17-41)21(6)30(38-34)16-32-23(8-2)19(4)28(36-32)15-31(22)35-27/h7,14-16,20,24,35-36,39-41H,1,8-13,17H2,2-6H3/b27-14-,28-15-,29-14-,30-16-,31-15-,32-16-,33-25-,34-25-/t20-,24-/m0/s1 |
| InChIKey | SEINWGJMKSWCHN-GATJIRQDSA-N |
| XLogP | 6.25 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |