C38H48ClN5O — CID 170399294
N-(5-chloropentyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide (PubChem CID 170399294) has the molecular formula C38H48ClN5O and a molecular weight of 626.29 g/mol. Its IUPAC name is N-(5-chloropentyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide.
| Compound Name | N-(5-chloropentyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 170399294 |
| Molecular Formula | C38H48ClN5O |
| Molecular Weight | 626.29 g/mol |
| Exact Mass | 625.35 |
| IUPAC Name | N-(5-chloropentyl)-3-[(2S,3S)-8-ethenyl-13-ethyl-3,7,12,17,20-pentamethyl-2,3,22,23-tetrahydroporphyrin-2-yl]-N-methylpropanamide |
| SMILES | C=Cc1c(C)c2cc3nc(c(C)c4nc(cc5[nH]c(cc1[nH]2)c(C)c5CC)C(C)=C4)[C@@H](CCC(=O)N(C)CCCCCCl)[C@@H]3C |
| InChI | InChI=1S/C38H48ClN5O/c1-9-27-24(5)33-21-36-28(10-2)23(4)32(41-36)20-34-25(6)29(14-15-37(45)44(8)17-13-11-12-16-39)38(43-34)26(7)31-18-22(3)30(40-31)19-35(27)42-33/h10,18-21,25,29,41-42H,2,9,11-17H2,1,3-8H3/b30-19-,31-26-,32-20-,33-21-,34-20-,35-19-,36-21-,38-26-/t25-,29-/m0/s1 |
| InChIKey | FMFOKUROYZRBIV-UTDCCGOBSA-N |
| XLogP | 9.54 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.29 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|