C41H44N6O5 — CID 164615752
dimethyl (17S,18S)-18-[3-(2-aminoanilino)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2,20-dicarboxylate (PubChem CID 164615752) has the molecular formula C41H44N6O5 and a molecular weight of 700.80 g/mol. Its IUPAC name is dimethyl (17S,18S)-18-[3-(2-aminoanilino)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2,20-dicarboxylate.
| Compound Name | dimethyl (17S,18S)-18-[3-(2-aminoanilino)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2,20-dicarboxylate |
|---|---|
| PubChem CID | 164615752 |
| Molecular Formula | C41H44N6O5 |
| Molecular Weight | 700.80 g/mol |
| Exact Mass | 700.34 |
| IUPAC Name | dimethyl (17S,18S)-18-[3-(2-aminoanilino)-3-oxopropyl]-12-ethenyl-7-ethyl-3,8,13,17-tetramethyl-17,18,22,23-tetrahydroporphyrin-2,20-dicarboxylate |
| SMILES | CCC1=C(C2=CC3=C(C(=C(N3)C=C4[C@H]([C@@H](C(=N4)C(=C5C(=C(C(=N5)C=C1N2)C)C(=O)OC)C(=O)OC)CCC(=O)NC6=CC=CC=C6N)C)C)C=C)C |
| InChI | InChI=1S/C41H44N6O5/c1-9-24-20(3)29-17-31-22(5)26(15-16-35(48)45-28-14-12-11-13-27(28)42)38(46-31)37(41(50)52-8)39-36(40(49)51-7)23(6)32(47-39)19-34-25(10-2)21(4)30(44-34)18-33(24)43-29/h9,11-14,17-19,22,26,43-44H,1,10,15-16,42H2,2-8H3,(H,45,48)/t22-,26-/m0/s1 |
| InChIKey | QENSBMSRJBIHGJ-NVQXNPDNSA-N |
| XLogP | 6.00 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | 1280 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|