C38H46N6O7 — CID 152764652
3-[18-[2-(2-aminoethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid (PubChem CID 152764652) has the molecular formula C38H46N6O7 and a molecular weight of 698.82 g/mol. Its IUPAC name is 3-[18-[2-(2-aminoethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid.
| Compound Name | 3-[18-[2-(2-aminoethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 152764652 |
| Molecular Formula | C38H46N6O7 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 3-[18-[2-(2-aminoethoxy)ethylcarbamoyl]-13-ethyl-8-(hydroxymethylidene)-20-(2-methoxy-2-oxoethyl)-3,7,12,17-tetramethyl-3,21-dihydro-2H-porphyrin-2-yl]propanoic acid |
| SMILES | CCC1=C(C)/C2=C/C3=NC(=C(C)C3=CO)/C=C3\N/C(=C(/CC(=O)OC)C4=N/C(=C\C1=N2)C(C)=C4C(=O)NCCOCCN)C(CCC(=O)O)C3C |
| InChI | InChI=1S/C38H46N6O7/c1-7-23-19(2)28-16-32-26(18-45)21(4)27(42-32)15-29-20(3)24(8-9-33(46)47)36(43-29)25(14-34(48)50-6)37-35(38(49)40-11-13-51-12-10-39)22(5)30(44-37)17-31(23)41-28/h15-18,20,24,43,45H,7-14,39H2,1-6H3,(H,40,49)(H,46,47)/b26-18?,28-16-,29-15-,30-17-,36-25- |
| InChIKey | FUAXBYAXHXJRGA-WKHUTJISSA-N |
| XLogP | 4.40 |
| TPSA | 197.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|