C39H48N4O — CID 135539177
3-(2,3,7,8,12,13,17,18-octaethyl-23H-porphyrin-5-ylidene)prop-1-en-1-ol (PubChem CID 135539177) has the molecular formula C39H48N4O and a molecular weight of 588.84 g/mol. Its IUPAC name is 3-(2,3,7,8,12,13,17,18-octaethyl-23H-porphyrin-5-ylidene)prop-1-en-1-ol.
| Compound Name | 3-(2,3,7,8,12,13,17,18-octaethyl-23H-porphyrin-5-ylidene)prop-1-en-1-ol |
|---|---|
| PubChem CID | 135539177 |
| Molecular Formula | C39H48N4O |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.38 |
| IUPAC Name | 3-(2,3,7,8,12,13,17,18-octaethyl-23H-porphyrin-5-ylidene)prop-1-en-1-ol |
| SMILES | CCC1=C(CC)/C2=C/c3[nH]c(c(CC)c3CC)/C=C3\N=C(C(=CC=CO)C4=N/C(=C\C1=N2)C(CC)=C4CC)C(CC)=C3CC |
| InChI | InChI=1S/C39H48N4O/c1-9-23-25(11-3)34-21-36-27(13-5)29(15-7)38(42-36)31(18-17-19-44)39-30(16-8)28(14-6)37(43-39)22-35-26(12-4)24(10-2)33(41-35)20-32(23)40-34/h17-22,40,44H,9-16H2,1-8H3/b19-17?,31-18?,33-20-,36-21-,37-22- |
| InChIKey | CNYFILFNMOKNPL-SZCMGURISA-N |
| XLogP | 10.43 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|