C34H42N4O2 — CID 137271343
(2S)-2,7,8,12,13,17,18-heptaethyl-21H-porphyrin-2,3-diol (PubChem CID 137271343) has the molecular formula C34H42N4O2 and a molecular weight of 538.74 g/mol. Its IUPAC name is (2S)-2,7,8,12,13,17,18-heptaethyl-21H-porphyrin-2,3-diol.
| Compound Name | (2S)-2,7,8,12,13,17,18-heptaethyl-21H-porphyrin-2,3-diol |
|---|---|
| PubChem CID | 137271343 |
| Molecular Formula | C34H42N4O2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | (2S)-2,7,8,12,13,17,18-heptaethyl-21H-porphyrin-2,3-diol |
| SMILES | CCC1=C(CC)/C2=C/C3=N/C(=C\C4=C(O)[C@](O)(CC)/C(=C/C5=N/C(=C\C1=N2)C(CC)=C5CC)N4)C(CC)=C3CC |
| InChI | InChI=1S/C34H42N4O2/c1-8-19-20(9-2)26-16-28-23(12-5)24(13-6)30(37-28)18-32-34(40,14-7)33(39)31(38-32)17-29-22(11-4)21(10-3)27(36-29)15-25(19)35-26/h15-18,38-40H,8-14H2,1-7H3/b25-15-,28-16-,29-17-,32-18-/t34-/m0/s1 |
| InChIKey | QLRWVAXUVIDHCJ-NDIWYJOPSA-N |
| XLogP | 7.76 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |