C23H18N4 — CID 67743305
2-ethyl-3-methylporphyrin (PubChem CID 67743305) has the molecular formula C23H18N4 and a molecular weight of 350.43 g/mol. Its IUPAC name is 2-ethyl-3-methylporphyrin.
| Compound Name | 2-ethyl-3-methylporphyrin |
|---|---|
| PubChem CID | 67743305 |
| Molecular Formula | C23H18N4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 2-ethyl-3-methylporphyrin |
| SMILES | CCC1=C(C)C2=N/C1=C\C1=N/C(=C\C3=N/C(=C\C4=N/C(=C\2)C=C4)C=C3)C=C1 |
| InChI | InChI=1S/C23H18N4/c1-3-21-14(2)22-12-19-8-6-17(25-19)10-15-4-5-16(24-15)11-18-7-9-20(26-18)13-23(21)27-22/h4-13H,3H2,1-2H3/b15-10-,16-11-,17-10-,18-11-,19-12-,20-13-,22-12-,23-13- |
| InChIKey | IWBWARYAAOREOW-FWWWHUSTSA-N |
| XLogP | 4.75 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |